Cal11 calculator

Calculate Ph of 0.1000 M Ethylamine

Reviewed by Calculator Editorial Team

Determining the pH of a 0.1000 M ethylamine solution is essential for understanding its chemical properties and behavior. This guide provides a step-by-step method for calculating the pH, explains the underlying chemistry, and discusses practical applications.

Introduction

The pH of a solution is a measure of its acidity or basicity, defined as the negative logarithm of the hydrogen ion concentration. For weak bases like ethylamine, the pH cannot be directly calculated using simple stoichiometry and must be determined using equilibrium calculations.

Ethylamine (C2H5NH2) is a weak organic base that dissociates in water to form ethylammonium ions and hydroxide ions. The pH of an ethylamine solution depends on its concentration and the equilibrium constants of its dissociation reactions.

How to Calculate pH

Calculating the pH of a 0.1000 M ethylamine solution involves several steps:

  1. Determine the dissociation constant (Kb) of ethylamine
  2. Calculate the concentration of ethylammonium ions and hydroxide ions at equilibrium
  3. Determine the hydrogen ion concentration from the hydroxide concentration
  4. Calculate the pH from the hydrogen ion concentration

Key Formula

The dissociation reaction of ethylamine is:

C2H5NH2 + H2O ⇌ C2H5NH3+ + OH-

The equilibrium constant expression is:

Kb = [C2H5NH3+][OH-]/[C2H5NH2]

For a 0.1000 M ethylamine solution, we can use the known Kb value of ethylamine (approximately 4.4 × 10-4 at 25°C) to calculate the pH.

Note: The Kb value may vary slightly depending on temperature and solvent. Always verify the Kb value for your specific conditions.

Ethylamine Basics

Ethylamine is a colorless, volatile liquid with an ammonia-like odor. It is used in the production of dyes, pharmaceuticals, and as a corrosion inhibitor. In aqueous solution, ethylamine behaves as a weak base due to the partial positive charge on the nitrogen atom.

Properties of Ethylamine
Property Value
Molecular Formula C2H5NH2
Molar Mass 45.08 g/mol
Boiling Point 56°C
pKb at 25°C 3.64

Practical Applications

The pH of ethylamine solutions is important in several industrial and laboratory applications:

  • Buffer solutions in biochemical research
  • Corrosion inhibition in metal processing
  • Production of pharmaceutical intermediates
  • Water treatment and pH adjustment

Understanding the pH of ethylamine solutions helps chemists and engineers control reaction conditions, maintain product quality, and ensure safety in handling these compounds.

FAQ

What is the pH of a 0.1000 M ethylamine solution?
The pH of a 0.1000 M ethylamine solution is approximately 10.35 at 25°C, calculated using the dissociation constant of ethylamine.
How does temperature affect the pH of ethylamine solutions?
Temperature affects the dissociation constant (Kb) of ethylamine. Higher temperatures generally increase Kb, resulting in a higher pH for the same concentration.
Can ethylamine solutions be used as buffers?
Yes, ethylamine solutions can be used as buffers when combined with appropriate acids. The buffer capacity depends on the concentration of ethylamine and its dissociation constant.
What safety precautions should be taken when handling ethylamine?
Ethylamine is toxic and volatile. Handle it in a well-ventilated area, wear appropriate protective equipment, and avoid inhalation or skin contact.